C11H10ClF2N3O — CID 82774698
[5-(4-chloro-2,5-difluorophenyl)-4-ethyl-1,2,4-triazol-3-yl]methanol (PubChem CID 82774698) has the molecular formula C11H10ClF2N3O and a molecular weight of 273.67 g/mol. Its IUPAC name is [5-(4-chloro-2,5-difluorophenyl)-4-ethyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(4-chloro-2,5-difluorophenyl)-4-ethyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 82774698 |
| Molecular Formula | C11H10ClF2N3O |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | [5-(4-chloro-2,5-difluorophenyl)-4-ethyl-1,2,4-triazol-3-yl]methanol |
| SMILES | CCn1c(CO)nnc1-c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H10ClF2N3O/c1-2-17-10(5-18)15-16-11(17)6-3-9(14)7(12)4-8(6)13/h3-4,18H,2,5H2,1H3 |
| InChIKey | QUGWWONVIUAUCE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|