C14H11Br3ClN — CID 82774723
2,5-dibromo-N-[1-(4-bromo-2-chlorophenyl)ethyl]aniline (PubChem CID 82774723) has the molecular formula C14H11Br3ClN and a molecular weight of 468.41 g/mol. Its IUPAC name is 2,5-dibromo-N-[1-(4-bromo-2-chlorophenyl)ethyl]aniline.
| Compound Name | 2,5-dibromo-N-[1-(4-bromo-2-chlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 82774723 |
| Molecular Formula | C14H11Br3ClN |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 464.81 |
| IUPAC Name | 2,5-dibromo-N-[1-(4-bromo-2-chlorophenyl)ethyl]aniline |
| SMILES | CC(Nc1cc(Br)ccc1Br)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H11Br3ClN/c1-8(11-4-2-9(15)6-13(11)18)19-14-7-10(16)3-5-12(14)17/h2-8,19H,1H3 |
| InChIKey | PVDLPZOMCBUSFS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |