C16H16N2O2S — CID 82774746
2-propyl-3-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid (PubChem CID 82774746) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-propyl-3-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-propyl-3-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82774746 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-propyl-3-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid |
| SMILES | CCCc1nc2ccc(C(=O)O)cc2n1Cc1ccsc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-2-3-15-17-13-5-4-12(16(19)20)8-14(13)18(15)9-11-6-7-21-10-11/h4-8,10H,2-3,9H2,1H3,(H,19,20) |
| InChIKey | VVAGQIWYHQPPFU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |