C15H13Br2ClFN — CID 82774821
1-(4-bromo-2-chlorophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine (PubChem CID 82774821) has the molecular formula C15H13Br2ClFN and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82774821 |
| Molecular Formula | C15H13Br2ClFN |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine |
| SMILES | CC(NCc1cc(F)ccc1Br)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H13Br2ClFN/c1-9(13-4-2-11(16)7-15(13)18)20-8-10-6-12(19)3-5-14(10)17/h2-7,9,20H,8H2,1H3 |
| InChIKey | IFPBTEIVPNLCIN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |