C10H13ClN2O2 — CID 82775389
5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-1-cyclopropylimidazole (PubChem CID 82775389) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-1-cyclopropylimidazole.
| Compound Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-1-cyclopropylimidazole |
|---|---|
| PubChem CID | 82775389 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-1-cyclopropylimidazole |
| SMILES | ClCC1COC(c2cncn2C2CC2)O1 |
| InChI | InChI=1S/C10H13ClN2O2/c11-3-8-5-14-10(15-8)9-4-12-6-13(9)7-1-2-7/h4,6-8,10H,1-3,5H2 |
| InChIKey | SEFOFJYPDTXOIP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|