About (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine
(7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine (PubChem CID 82775424) has the molecular formula C7H13NO4S
and a molecular weight of 207.25 g/mol. Its IUPAC name is (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine.
Molecular Properties
| Compound Name | (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine |
| PubChem CID | 82775424 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine |
| SMILES | NCC1COC2(CCS(=O)(=O)C2)O1 |
| InChI | InChI=1S/C7H13NO4S/c8-3-6-4-11-7(12-6)1-2-13(9,10)5-7/h6H,1-5,8H2 |
| InChIKey | NWELEEOMLMLDBK-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine?
The IUPAC name of (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine (CID 82775424) is (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine.
What is the SMILES notation for (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine?
The canonical SMILES for (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine is NCC1COC2(CCS(=O)(=O)C2)O1.
What is the InChIKey of (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine?
The InChIKey is NWELEEOMLMLDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S/c8-3-6-4-11-7(12-6)1-2-13(9,10)5-7/h6H,1-5,8H2.
What are the key properties of (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine?
(7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine has a molecular weight of 207.25 g/mol, XLogP of -1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dioxo-1,4-dioxa-7λ6-thiaspiro[4.4]nonan-3-yl)methanamine is sourced from PubChem (CID 82775424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).