C10H9Cl2FO2 — CID 82776123
2-(4-chloro-3-fluorophenyl)-4-(chloromethyl)-1,3-dioxolane (PubChem CID 82776123) has the molecular formula C10H9Cl2FO2 and a molecular weight of 251.08 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-4-(chloromethyl)-1,3-dioxolane.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-4-(chloromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 82776123 |
| Molecular Formula | C10H9Cl2FO2 |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-4-(chloromethyl)-1,3-dioxolane |
| SMILES | Fc1cc(C2OCC(CCl)O2)ccc1Cl |
| InChI | InChI=1S/C10H9Cl2FO2/c11-4-7-5-14-10(15-7)6-1-2-8(12)9(13)3-6/h1-3,7,10H,4-5H2 |
| InChIKey | ZCGFAJVFBRQGQD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|