About 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide
4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 82776625) has the molecular formula C13H20N2O4S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 82776625 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C2(C)OCC(CN)O2)cc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-13(18-9-11(8-14)19-13)10-4-6-12(7-5-10)20(16,17)15(2)3/h4-7,11H,8-9,14H2,1-3H3 |
| InChIKey | VRCRUVINYYTZOP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide (CID 82776625) is 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1ccc(C2(C)OCC(CN)O2)cc1.
What is the InChIKey of 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide?
The InChIKey is VRCRUVINYYTZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4S/c1-13(18-9-11(8-14)19-13)10-4-6-12(7-5-10)20(16,17)15(2)3/h4-7,11H,8-9,14H2,1-3H3.
What are the key properties of 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide?
4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide has a molecular weight of 300.38 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-2-methyl-1,3-dioxolan-2-yl]-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 82776625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).