C16H26N2O3 — CID 82777016
ethyl 4-amino-3-[2-hydroxyethyl(pentan-3-yl)amino]benzoate (PubChem CID 82777016) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl 4-amino-3-[2-hydroxyethyl(pentan-3-yl)amino]benzoate.
| Compound Name | ethyl 4-amino-3-[2-hydroxyethyl(pentan-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 82777016 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethyl 4-amino-3-[2-hydroxyethyl(pentan-3-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(N(CCO)C(CC)CC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-13(5-2)18(9-10-19)15-11-12(7-8-14(15)17)16(20)21-6-3/h7-8,11,13,19H,4-6,9-10,17H2,1-3H3 |
| InChIKey | VUIIUBSFPOZTDY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|