About 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol
3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol (PubChem CID 82778654) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol |
| PubChem CID | 82778654 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol |
| SMILES | Oc1cccc(C2OCC(CCl)O2)c1 |
| InChI | InChI=1S/C10H11ClO3/c11-5-9-6-13-10(14-9)7-2-1-3-8(12)4-7/h1-4,9-10,12H,5-6H2 |
| InChIKey | GBPSPBLNGGWKCH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol?
The IUPAC name of 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol (CID 82778654) is 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol.
What is the SMILES notation for 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol?
The canonical SMILES for 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol is Oc1cccc(C2OCC(CCl)O2)c1.
What is the InChIKey of 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol?
The InChIKey is GBPSPBLNGGWKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c11-5-9-6-13-10(14-9)7-2-1-3-8(12)4-7/h1-4,9-10,12H,5-6H2.
What are the key properties of 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol?
3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol has a molecular weight of 214.65 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(chloromethyl)-1,3-dioxolan-2-yl]phenol is sourced from PubChem (CID 82778654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).