C10H11ClN2O5 — CID 82780881
3-chloro-N-(2,3-dihydroxypropyl)-4-nitrobenzamide (PubChem CID 82780881) has the molecular formula C10H11ClN2O5 and a molecular weight of 274.66 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dihydroxypropyl)-4-nitrobenzamide.
| Compound Name | 3-chloro-N-(2,3-dihydroxypropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 82780881 |
| Molecular Formula | C10H11ClN2O5 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 3-chloro-N-(2,3-dihydroxypropyl)-4-nitrobenzamide |
| SMILES | O=C(NCC(O)CO)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2O5/c11-8-3-6(1-2-9(8)13(17)18)10(16)12-4-7(15)5-14/h1-3,7,14-15H,4-5H2,(H,12,16) |
| InChIKey | NKMGFFPMJVISKW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|