C15H21BrClNO2 — CID 82781390
1-(4-bromo-2-chlorophenyl)-3-[methyl-(2-methyloxolan-3-yl)amino]propan-1-ol (PubChem CID 82781390) has the molecular formula C15H21BrClNO2 and a molecular weight of 362.70 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[methyl-(2-methyloxolan-3-yl)amino]propan-1-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[methyl-(2-methyloxolan-3-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 82781390 |
| Molecular Formula | C15H21BrClNO2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[methyl-(2-methyloxolan-3-yl)amino]propan-1-ol |
| SMILES | CC1OCCC1N(C)CCC(O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H21BrClNO2/c1-10-14(6-8-20-10)18(2)7-5-15(19)12-4-3-11(16)9-13(12)17/h3-4,9-10,14-15,19H,5-8H2,1-2H3 |
| InChIKey | GFLWLZYKTQBWMT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |