C13H17BrClNO3 — CID 82781404
2-[1-(4-bromo-2-chlorophenyl)ethyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 82781404) has the molecular formula C13H17BrClNO3 and a molecular weight of 350.64 g/mol. Its IUPAC name is 2-[1-(4-bromo-2-chlorophenyl)ethyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[1-(4-bromo-2-chlorophenyl)ethyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 82781404 |
| Molecular Formula | C13H17BrClNO3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-[1-(4-bromo-2-chlorophenyl)ethyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(C)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrClNO3/c1-9(11-4-3-10(14)7-12(11)15)16(5-6-19-2)8-13(17)18/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | HYPZPIRVWBTVDZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |