About 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid
4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid (PubChem CID 82781639) has the molecular formula C13H11F3N2O3
and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid |
| PubChem CID | 82781639 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid |
| SMILES | O=C(O)c1nc(OCCCC(F)(F)F)c2ccccc2n1 |
| InChI | InChI=1S/C13H11F3N2O3/c14-13(15,16)6-3-7-21-11-8-4-1-2-5-9(8)17-10(18-11)12(19)20/h1-2,4-5H,3,6-7H2,(H,19,20) |
| InChIKey | YYWHOZAWERIMIJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid?
The IUPAC name of 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid (CID 82781639) is 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid.
What is the SMILES notation for 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid?
The canonical SMILES for 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid is O=C(O)c1nc(OCCCC(F)(F)F)c2ccccc2n1.
What is the InChIKey of 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid?
The InChIKey is YYWHOZAWERIMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O3/c14-13(15,16)6-3-7-21-11-8-4-1-2-5-9(8)17-10(18-11)12(19)20/h1-2,4-5H,3,6-7H2,(H,19,20).
What are the key properties of 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid?
4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid has a molecular weight of 300.24 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4,4-trifluorobutoxy)quinazoline-2-carboxylic acid is sourced from PubChem (CID 82781639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).