C16H24BrClN2 — CID 82781669
1-(4-bromo-2-chlorophenyl)-3-(2-methylazepan-1-yl)propan-1-amine (PubChem CID 82781669) has the molecular formula C16H24BrClN2 and a molecular weight of 359.74 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(2-methylazepan-1-yl)propan-1-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(2-methylazepan-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 82781669 |
| Molecular Formula | C16H24BrClN2 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(2-methylazepan-1-yl)propan-1-amine |
| SMILES | CC1CCCCCN1CCC(N)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H24BrClN2/c1-12-5-3-2-4-9-20(12)10-8-16(19)14-7-6-13(17)11-15(14)18/h6-7,11-12,16H,2-5,8-10,19H2,1H3 |
| InChIKey | BOCQWWVHTAAVKK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |