C11H15F3N6O — CID 82782495
[1-methyl-6-(4,4,4-trifluorobutoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 82782495) has the molecular formula C11H15F3N6O and a molecular weight of 304.28 g/mol. Its IUPAC name is [1-methyl-6-(4,4,4-trifluorobutoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [1-methyl-6-(4,4,4-trifluorobutoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82782495 |
| Molecular Formula | C11H15F3N6O |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [1-methyl-6-(4,4,4-trifluorobutoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cn1ncc2c(NN)nc(COCCCC(F)(F)F)nc21 |
| InChI | InChI=1S/C11H15F3N6O/c1-20-10-7(5-16-20)9(19-15)17-8(18-10)6-21-4-2-3-11(12,13)14/h5H,2-4,6,15H2,1H3,(H,17,18,19) |
| InChIKey | BOTUCMOVJVTONM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|