C17H14FNO — CID 82782530
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-4-fluoroindole (PubChem CID 82782530) has the molecular formula C17H14FNO and a molecular weight of 267.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-4-fluoroindole.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-4-fluoroindole |
|---|---|
| PubChem CID | 82782530 |
| Molecular Formula | C17H14FNO |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-4-fluoroindole |
| SMILES | Fc1cccc2c1ccn2CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H14FNO/c18-15-5-3-6-16-14(15)8-9-19(16)11-13-10-12-4-1-2-7-17(12)20-13/h1-9,13H,10-11H2 |
| InChIKey | GHPZASAFXSYYTC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |