About 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide
1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide (PubChem CID 82782625) has the molecular formula C12H20F3N3O3
and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide |
| PubChem CID | 82782625 |
| Molecular Formula | C12H20F3N3O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide |
| SMILES | NNC(=O)C1CCN(C(=O)COCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3N3O3/c13-12(14,15)4-1-7-21-8-10(19)18-5-2-9(3-6-18)11(20)17-16/h9H,1-8,16H2,(H,17,20) |
| InChIKey | OWFODWSQQTXLHV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide?
The IUPAC name of 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide (CID 82782625) is 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide.
What is the SMILES notation for 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide?
The canonical SMILES for 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide is NNC(=O)C1CCN(C(=O)COCCCC(F)(F)F)CC1.
What is the InChIKey of 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide?
The InChIKey is OWFODWSQQTXLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3O3/c13-12(14,15)4-1-7-21-8-10(19)18-5-2-9(3-6-18)11(20)17-16/h9H,1-8,16H2,(H,17,20).
What are the key properties of 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide?
1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide has a molecular weight of 311.30 g/mol, XLogP of 0.57, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4,4-trifluorobutoxy)acetyl]piperidine-4-carbohydrazide is sourced from PubChem (CID 82782625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).