C14H11Cl2F2NO — CID 82782889
(4-chloro-2,5-difluorophenyl)-(3-chloro-4-methoxyphenyl)methanamine (PubChem CID 82782889) has the molecular formula C14H11Cl2F2NO and a molecular weight of 318.15 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(3-chloro-4-methoxyphenyl)methanamine.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(3-chloro-4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 82782889 |
| Molecular Formula | C14H11Cl2F2NO |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(3-chloro-4-methoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2cc(F)c(Cl)cc2F)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F2NO/c1-20-13-3-2-7(4-10(13)16)14(19)8-5-12(18)9(15)6-11(8)17/h2-6,14H,19H2,1H3 |
| InChIKey | FBJUUBIXSPBEFU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|