C16H16ClF2N — CID 82783500
1-[2-chloro-4-(2,4-difluorophenyl)phenyl]-N-ethylethanamine (PubChem CID 82783500) has the molecular formula C16H16ClF2N and a molecular weight of 295.76 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,4-difluorophenyl)phenyl]-N-ethylethanamine.
| Compound Name | 1-[2-chloro-4-(2,4-difluorophenyl)phenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 82783500 |
| Molecular Formula | C16H16ClF2N |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-[2-chloro-4-(2,4-difluorophenyl)phenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(-c2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C16H16ClF2N/c1-3-20-10(2)13-6-4-11(8-15(13)17)14-7-5-12(18)9-16(14)19/h4-10,20H,3H2,1-2H3 |
| InChIKey | ANCDTAQPDAEEFC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |