About (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone
(4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone (PubChem CID 827837) has the molecular formula C16H12ClN3O
and a molecular weight of 297.75 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone |
| PubChem CID | 827837 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCn2c1nc1ccccc12 |
| InChI | InChI=1S/C16H12ClN3O/c17-12-7-5-11(6-8-12)15(21)20-10-9-19-14-4-2-1-3-13(14)18-16(19)20/h1-8H,9-10H2 |
| InChIKey | GMQXFPOFNLZXDK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone?
The IUPAC name of (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone (CID 827837) is (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone.
What is the SMILES notation for (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone?
The canonical SMILES for (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone is O=C(c1ccc(Cl)cc1)N1CCn2c1nc1ccccc12.
What is the InChIKey of (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone?
The InChIKey is GMQXFPOFNLZXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3O/c17-12-7-5-11(6-8-12)15(21)20-10-9-19-14-4-2-1-3-13(14)18-16(19)20/h1-8H,9-10H2.
What are the key properties of (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone?
(4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone has a molecular weight of 297.75 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)methanone is sourced from PubChem (CID 827837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).