C13H23F3N2O2 — CID 82786161
N-(2,2-diethyloxan-4-yl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 82786161) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 82786161 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CCC1(CC)CC(NC(=O)CNCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-3-12(4-2)7-10(5-6-20-12)18-11(19)8-17-9-13(14,15)16/h10,17H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | CREOZGADROGQIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |