C11H18F3NO2 — CID 82786538
N-(2,2-diethyloxan-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 82786538) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 82786538 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCC1(CC)CC(NC(=O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H18F3NO2/c1-3-10(4-2)7-8(5-6-17-10)15-9(16)11(12,13)14/h8H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | FWRUHGCNPIKADI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |