C16H14ClNO2 — CID 82787273
7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate (PubChem CID 82787273) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate.
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 82787273 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate |
| SMILES | Nc1ccc(C(=O)OCC2Cc3ccccc32)cc1Cl |
| InChI | InChI=1S/C16H14ClNO2/c17-14-8-11(5-6-15(14)18)16(19)20-9-12-7-10-3-1-2-4-13(10)12/h1-6,8,12H,7,9,18H2 |
| InChIKey | BQCRFAXEUKLWLF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|