About 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate
7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate (PubChem CID 82787273) has the molecular formula C16H14ClNO2
and a molecular weight of 287.75 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate.
Molecular Properties
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate |
| PubChem CID | 82787273 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate |
| SMILES | Nc1ccc(C(=O)OCC2Cc3ccccc32)cc1Cl |
| InChI | InChI=1S/C16H14ClNO2/c17-14-8-11(5-6-15(14)18)16(19)20-9-12-7-10-3-1-2-4-13(10)12/h1-6,8,12H,7,9,18H2 |
| InChIKey | BQCRFAXEUKLWLF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate?
The IUPAC name of 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate (CID 82787273) is 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate.
What is the SMILES notation for 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate?
The canonical SMILES for 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate is Nc1ccc(C(=O)OCC2Cc3ccccc32)cc1Cl.
What is the InChIKey of 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate?
The InChIKey is BQCRFAXEUKLWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO2/c17-14-8-11(5-6-15(14)18)16(19)20-9-12-7-10-3-1-2-4-13(10)12/h1-6,8,12H,7,9,18H2.
What are the key properties of 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate?
7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate has a molecular weight of 287.75 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl 4-amino-3-chlorobenzoate is sourced from PubChem (CID 82787273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).