C10H9F3N2O — CID 82788068
6-(4,4,4-trifluorobutoxy)pyridine-3-carbonitrile (PubChem CID 82788068) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 6-(4,4,4-trifluorobutoxy)pyridine-3-carbonitrile.
| Compound Name | 6-(4,4,4-trifluorobutoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82788068 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 6-(4,4,4-trifluorobutoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(OCCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)4-1-5-16-9-3-2-8(6-14)7-15-9/h2-3,7H,1,4-5H2 |
| InChIKey | NWFKWMHWGCASIL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|