C13H17F3N2O2 — CID 82788195
N-(2-amino-6-methylphenyl)-2-(4,4,4-trifluorobutoxy)acetamide (PubChem CID 82788195) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-(2-amino-6-methylphenyl)-2-(4,4,4-trifluorobutoxy)acetamide.
| Compound Name | N-(2-amino-6-methylphenyl)-2-(4,4,4-trifluorobutoxy)acetamide |
|---|---|
| PubChem CID | 82788195 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(2-amino-6-methylphenyl)-2-(4,4,4-trifluorobutoxy)acetamide |
| SMILES | Cc1cccc(N)c1NC(=O)COCCCC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O2/c1-9-4-2-5-10(17)12(9)18-11(19)8-20-7-3-6-13(14,15)16/h2,4-5H,3,6-8,17H2,1H3,(H,18,19) |
| InChIKey | PODCMEJXRVIDID-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|