C10H9Br2F3O2S — CID 82788274
1-(2,5-dibromothiophen-3-yl)-2-(4,4,4-trifluorobutoxy)ethanone (PubChem CID 82788274) has the molecular formula C10H9Br2F3O2S and a molecular weight of 410.05 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(4,4,4-trifluorobutoxy)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(4,4,4-trifluorobutoxy)ethanone |
|---|---|
| PubChem CID | 82788274 |
| Molecular Formula | C10H9Br2F3O2S |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 407.86 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(4,4,4-trifluorobutoxy)ethanone |
| SMILES | O=C(COCCCC(F)(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H9Br2F3O2S/c11-8-4-6(9(12)18-8)7(16)5-17-3-1-2-10(13,14)15/h4H,1-3,5H2 |
| InChIKey | KORZJJUWXWZHOY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|