About [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol
[2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol (PubChem CID 82788277) has the molecular formula C12H17F3N2O2
and a molecular weight of 278.27 g/mol. Its IUPAC name is [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol |
| PubChem CID | 82788277 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol |
| SMILES | CC(C)c1ncc(OCCCC(F)(F)F)c(CO)n1 |
| InChI | InChI=1S/C12H17F3N2O2/c1-8(2)11-16-6-10(9(7-18)17-11)19-5-3-4-12(13,14)15/h6,8,18H,3-5,7H2,1-2H3 |
| InChIKey | UHEYOBOFMIREKV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol?
The IUPAC name of [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol (CID 82788277) is [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol?
The canonical SMILES for [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol is CC(C)c1ncc(OCCCC(F)(F)F)c(CO)n1.
What is the InChIKey of [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol?
The InChIKey is UHEYOBOFMIREKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O2/c1-8(2)11-16-6-10(9(7-18)17-11)19-5-3-4-12(13,14)15/h6,8,18H,3-5,7H2,1-2H3.
What are the key properties of [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol?
[2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol has a molecular weight of 278.27 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]methanol is sourced from PubChem (CID 82788277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).