C12H15F4NO — CID 82788790
(1S)-1-[2-fluoro-6-(4,4,4-trifluorobutoxy)phenyl]ethanamine (PubChem CID 82788790) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-6-(4,4,4-trifluorobutoxy)phenyl]ethanamine.
| Compound Name | (1S)-1-[2-fluoro-6-(4,4,4-trifluorobutoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 82788790 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1S)-1-[2-fluoro-6-(4,4,4-trifluorobutoxy)phenyl]ethanamine |
| SMILES | C[C@H](N)c1c(F)cccc1OCCCC(F)(F)F |
| InChI | InChI=1S/C12H15F4NO/c1-8(17)11-9(13)4-2-5-10(11)18-7-3-6-12(14,15)16/h2,4-5,8H,3,6-7,17H2,1H3/t8-/m0/s1 |
| InChIKey | MXEJQKRWMBUXIA-QMMMGPOBSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|