C10H15F3N4O — CID 82789125
1,3-dimethyl-5-(4,4,4-trifluorobutoxy)pyrazole-4-carboximidamide (PubChem CID 82789125) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4,4,4-trifluorobutoxy)pyrazole-4-carboximidamide.
| Compound Name | 1,3-dimethyl-5-(4,4,4-trifluorobutoxy)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 82789125 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1,3-dimethyl-5-(4,4,4-trifluorobutoxy)pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N4O/c1-6-7(8(14)15)9(17(2)16-6)18-5-3-4-10(11,12)13/h3-5H2,1-2H3,(H3,14,15) |
| InChIKey | AQVGJEXVWQIJNL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|