About 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid
2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid (PubChem CID 82789412) has the molecular formula C12H15F3N2O3
and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid |
| PubChem CID | 82789412 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid |
| SMILES | CC(C)c1ncc(OCCCC(F)(F)F)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H15F3N2O3/c1-7(2)10-16-6-8(9(17-10)11(18)19)20-5-3-4-12(13,14)15/h6-7H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | MVQROYJWMGXRCS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid?
The IUPAC name of 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid (CID 82789412) is 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid?
The canonical SMILES for 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid is CC(C)c1ncc(OCCCC(F)(F)F)c(C(=O)O)n1.
What is the InChIKey of 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid?
The InChIKey is MVQROYJWMGXRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O3/c1-7(2)10-16-6-8(9(17-10)11(18)19)20-5-3-4-12(13,14)15/h6-7H,3-5H2,1-2H3,(H,18,19).
What are the key properties of 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid?
2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid has a molecular weight of 292.26 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5-(4,4,4-trifluorobutoxy)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 82789412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).