About [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol
[6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol (PubChem CID 82789486) has the molecular formula C9H11F3N2O2
and a molecular weight of 236.19 g/mol. Its IUPAC name is [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol |
| PubChem CID | 82789486 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol |
| SMILES | OCc1cncc(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O2/c10-9(11,12)2-1-3-16-8-5-13-4-7(6-15)14-8/h4-5,15H,1-3,6H2 |
| InChIKey | HYQCIFZHXOCUTQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol?
The IUPAC name of [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol (CID 82789486) is [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol.
What is the SMILES notation for [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol?
The canonical SMILES for [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol is OCc1cncc(OCCCC(F)(F)F)n1.
What is the InChIKey of [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol?
The InChIKey is HYQCIFZHXOCUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2/c10-9(11,12)2-1-3-16-8-5-13-4-7(6-15)14-8/h4-5,15H,1-3,6H2.
What are the key properties of [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol?
[6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol has a molecular weight of 236.19 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4,4,4-trifluorobutoxy)pyrazin-2-yl]methanol is sourced from PubChem (CID 82789486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).