C12H14F3NO3 — CID 82789711
6-(4,4,4-trifluorobutoxy)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 82789711) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 6-(4,4,4-trifluorobutoxy)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(4,4,4-trifluorobutoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 82789711 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-(4,4,4-trifluorobutoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1OCCCC(F)(F)F)OCCO2 |
| InChI | InChI=1S/C12H14F3NO3/c13-12(14,15)2-1-3-17-9-7-11-10(6-8(9)16)18-4-5-19-11/h6-7H,1-5,16H2 |
| InChIKey | PMLHKFCAQNHNEW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|