About 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline
4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline (PubChem CID 82789714) has the molecular formula C12H16F3NO
and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline.
Molecular Properties
| Compound Name | 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline |
| PubChem CID | 82789714 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline |
| SMILES | CC(OCCCC(F)(F)F)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H16F3NO/c1-9(10-3-5-11(16)6-4-10)17-8-2-7-12(13,14)15/h3-6,9H,2,7-8,16H2,1H3 |
| InChIKey | XLCWKQJAAWVBHS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline?
The IUPAC name of 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline (CID 82789714) is 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline.
What is the SMILES notation for 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline?
The canonical SMILES for 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline is CC(OCCCC(F)(F)F)c1ccc(N)cc1.
What is the InChIKey of 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline?
The InChIKey is XLCWKQJAAWVBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO/c1-9(10-3-5-11(16)6-4-10)17-8-2-7-12(13,14)15/h3-6,9H,2,7-8,16H2,1H3.
What are the key properties of 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline?
4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline has a molecular weight of 247.26 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4,4,4-trifluorobutoxy)ethyl]aniline is sourced from PubChem (CID 82789714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).