C14H26F3NO — CID 82789739
2,2-dimethyl-N-propyl-5-(4,4,4-trifluorobutoxy)cyclopentan-1-amine (PubChem CID 82789739) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-propyl-5-(4,4,4-trifluorobutoxy)cyclopentan-1-amine.
| Compound Name | 2,2-dimethyl-N-propyl-5-(4,4,4-trifluorobutoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 82789739 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2,2-dimethyl-N-propyl-5-(4,4,4-trifluorobutoxy)cyclopentan-1-amine |
| SMILES | CCCNC1C(OCCCC(F)(F)F)CCC1(C)C |
| InChI | InChI=1S/C14H26F3NO/c1-4-9-18-12-11(6-8-13(12,2)3)19-10-5-7-14(15,16)17/h11-12,18H,4-10H2,1-3H3 |
| InChIKey | LEOUJIOIUWOLQI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|