C18H27ClFN — CID 82791443
N-[[1-(3-chloro-2-fluorophenyl)-3-propylcyclobutyl]methyl]-2-methylpropan-1-amine (PubChem CID 82791443) has the molecular formula C18H27ClFN and a molecular weight of 311.87 g/mol. Its IUPAC name is N-[[1-(3-chloro-2-fluorophenyl)-3-propylcyclobutyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(3-chloro-2-fluorophenyl)-3-propylcyclobutyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 82791443 |
| Molecular Formula | C18H27ClFN |
| Molecular Weight | 311.87 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[[1-(3-chloro-2-fluorophenyl)-3-propylcyclobutyl]methyl]-2-methylpropan-1-amine |
| SMILES | CCCC1CC(CNCC(C)C)(c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C18H27ClFN/c1-4-6-14-9-18(10-14,12-21-11-13(2)3)15-7-5-8-16(19)17(15)20/h5,7-8,13-14,21H,4,6,9-12H2,1-3H3 |
| InChIKey | PAKQPIAAZMCCLT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |