About 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide
1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide (PubChem CID 82791562) has the molecular formula C10H17F3N2O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide |
| PubChem CID | 82791562 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCC(OCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O2/c11-10(12,13)3-1-5-17-7-2-4-9(15,6-7)8(14)16/h7H,1-6,15H2,(H2,14,16) |
| InChIKey | DPHDTKMZCVUCRB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide?
The IUPAC name of 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide (CID 82791562) is 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide?
The canonical SMILES for 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide is NC(=O)C1(N)CCC(OCCCC(F)(F)F)C1.
What is the InChIKey of 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide?
The InChIKey is DPHDTKMZCVUCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2/c11-10(12,13)3-1-5-17-7-2-4-9(15,6-7)8(14)16/h7H,1-6,15H2,(H2,14,16).
What are the key properties of 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide?
1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide has a molecular weight of 254.25 g/mol, XLogP of 1.08, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(4,4,4-trifluorobutoxy)cyclopentane-1-carboxamide is sourced from PubChem (CID 82791562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).