C11H13F3N4OS — CID 82791579
[2-(4,4,4-trifluorobutoxymethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 82791579) has the molecular formula C11H13F3N4OS and a molecular weight of 306.31 g/mol. Its IUPAC name is [2-(4,4,4-trifluorobutoxymethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4,4,4-trifluorobutoxymethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82791579 |
| Molecular Formula | C11H13F3N4OS |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [2-(4,4,4-trifluorobutoxymethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(COCCCC(F)(F)F)nc2sccc12 |
| InChI | InChI=1S/C11H13F3N4OS/c12-11(13,14)3-1-4-19-6-8-16-9(18-15)7-2-5-20-10(7)17-8/h2,5H,1,3-4,6,15H2,(H,16,17,18) |
| InChIKey | JBCISXDWULLECQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|