C13H17F3N2O — CID 82791835
N-[[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]methyl]cyclopropanamine (PubChem CID 82791835) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-[[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 82791835 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[[4-(4,4,4-trifluorobutoxy)-2-pyridinyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)CCCOc1ccnc(CNC2CC2)c1 |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)5-1-7-19-12-4-6-17-11(8-12)9-18-10-2-3-10/h4,6,8,10,18H,1-3,5,7,9H2 |
| InChIKey | AXBXPCJLAJRCBZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|