C12H17F3N2O — CID 82791929
N-ethyl-2-(4,4,4-trifluorobutoxymethyl)pyridin-4-amine (PubChem CID 82791929) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is N-ethyl-2-(4,4,4-trifluorobutoxymethyl)pyridin-4-amine.
| Compound Name | N-ethyl-2-(4,4,4-trifluorobutoxymethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 82791929 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-ethyl-2-(4,4,4-trifluorobutoxymethyl)pyridin-4-amine |
| SMILES | CCNc1ccnc(COCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-2-16-10-4-6-17-11(8-10)9-18-7-3-5-12(13,14)15/h4,6,8H,2-3,5,7,9H2,1H3,(H,16,17) |
| InChIKey | QKDPIDVWMUVVIT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|