C13H26F3NO — CID 82792087
2,2-dimethyl-N-(2-methylpropyl)-3-(4,4,4-trifluorobutoxy)propan-1-amine (PubChem CID 82792087) has the molecular formula C13H26F3NO and a molecular weight of 269.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methylpropyl)-3-(4,4,4-trifluorobutoxy)propan-1-amine.
| Compound Name | 2,2-dimethyl-N-(2-methylpropyl)-3-(4,4,4-trifluorobutoxy)propan-1-amine |
|---|---|
| PubChem CID | 82792087 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2,2-dimethyl-N-(2-methylpropyl)-3-(4,4,4-trifluorobutoxy)propan-1-amine |
| SMILES | CC(C)CNCC(C)(C)COCCCC(F)(F)F |
| InChI | InChI=1S/C13H26F3NO/c1-11(2)8-17-9-12(3,4)10-18-7-5-6-13(14,15)16/h11,17H,5-10H2,1-4H3 |
| InChIKey | UGKKZQXAAIPAAS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|