C10H16F3N3OS — CID 82792181
N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine (PubChem CID 82792181) has the molecular formula C10H16F3N3OS and a molecular weight of 283.32 g/mol. Its IUPAC name is N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 82792181 |
| Molecular Formula | C10H16F3N3OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1nnc(OCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H16F3N3OS/c1-7(2)14-6-8-15-16-9(18-8)17-5-3-4-10(11,12)13/h7,14H,3-6H2,1-2H3 |
| InChIKey | NKOXYRAIZXGYKY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|