C17H20FNO2 — CID 82792923
1-(2-fluoro-3-methoxyphenyl)-1-(4-methoxy-3-methylphenyl)-N-methylmethanamine (PubChem CID 82792923) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)-1-(4-methoxy-3-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)-1-(4-methoxy-3-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82792923 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)-1-(4-methoxy-3-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(OC)c(C)c1)c1cccc(OC)c1F |
| InChI | InChI=1S/C17H20FNO2/c1-11-10-12(8-9-14(11)20-3)17(19-2)13-6-5-7-15(21-4)16(13)18/h5-10,17,19H,1-4H3 |
| InChIKey | VDWCYAPWPQTVAO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |