C10H14F3N3OS — CID 82792984
N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine (PubChem CID 82792984) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 82792984 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[[5-(4,4,4-trifluorobutoxy)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)CCCOc1nnc(CNC2CC2)s1 |
| InChI | InChI=1S/C10H14F3N3OS/c11-10(12,13)4-1-5-17-9-16-15-8(18-9)6-14-7-2-3-7/h7,14H,1-6H2 |
| InChIKey | SBYVSDCQKXREBH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|