C12H22F3NO2 — CID 82793017
N-[[5-(4,4,4-trifluorobutoxymethyl)oxolan-2-yl]methyl]ethanamine (PubChem CID 82793017) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[[5-(4,4,4-trifluorobutoxymethyl)oxolan-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(4,4,4-trifluorobutoxymethyl)oxolan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 82793017 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[[5-(4,4,4-trifluorobutoxymethyl)oxolan-2-yl]methyl]ethanamine |
| SMILES | CCNCC1CCC(COCCCC(F)(F)F)O1 |
| InChI | InChI=1S/C12H22F3NO2/c1-2-16-8-10-4-5-11(18-10)9-17-7-3-6-12(13,14)15/h10-11,16H,2-9H2,1H3 |
| InChIKey | MVNMYQHXLQXZME-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|