C11H16F3N5O — CID 82794418
4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine (PubChem CID 82794418) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82794418 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-pyrrolidin-1-yl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(OCCCC(F)(F)F)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H16F3N5O/c12-11(13,14)4-3-7-20-10-17-8(15)16-9(18-10)19-5-1-2-6-19/h1-7H2,(H2,15,16,17,18) |
| InChIKey | LRTDMKBZSLIKIP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|