About [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine
[2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine (PubChem CID 82794558) has the molecular formula C11H15F3N4O
and a molecular weight of 276.26 g/mol. Its IUPAC name is [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine |
| PubChem CID | 82794558 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(OCCCC(F)(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C11H15F3N4O/c12-11(13,14)4-1-5-19-9-6-8(18-15)16-10(17-9)7-2-3-7/h6-7H,1-5,15H2,(H,16,17,18) |
| InChIKey | RFYVYCGAXWLNGM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine (CID 82794558) is [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine is NNc1cc(OCCCC(F)(F)F)nc(C2CC2)n1.
What is the InChIKey of [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine?
The InChIKey is RFYVYCGAXWLNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N4O/c12-11(13,14)4-1-5-19-9-6-8(18-15)16-10(17-9)7-2-3-7/h6-7H,1-5,15H2,(H,16,17,18).
What are the key properties of [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine?
[2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine has a molecular weight of 276.26 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyclopropyl-6-(4,4,4-trifluorobutoxy)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 82794558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).