C10H15BrN2O — CID 82794580
2-[4-(aminomethyl)-2-bromo-N-methylanilino]ethanol (PubChem CID 82794580) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-bromo-N-methylanilino]ethanol.
| Compound Name | 2-[4-(aminomethyl)-2-bromo-N-methylanilino]ethanol |
|---|---|
| PubChem CID | 82794580 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-[4-(aminomethyl)-2-bromo-N-methylanilino]ethanol |
| SMILES | CN(CCO)c1ccc(CN)cc1Br |
| InChI | InChI=1S/C10H15BrN2O/c1-13(4-5-14)10-3-2-8(7-12)6-9(10)11/h2-3,6,14H,4-5,7,12H2,1H3 |
| InChIKey | PEXNFUDQAXJBJO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |