About 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine
6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine (PubChem CID 82794764) has the molecular formula C16H21F3N2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine |
| PubChem CID | 82794764 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine |
| SMILES | CC12CCC(C1)C(C)(C)C2Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H21F3N2/c1-14(2)10-6-7-15(3,8-10)13(14)21-11-4-5-12(20-9-11)16(17,18)19/h4-5,9-10,13,21H,6-8H2,1-3H3 |
| InChIKey | FWVBJEUOEICVGL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The IUPAC name of 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine (CID 82794764) is 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine.
What is the SMILES notation for 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The canonical SMILES for 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine is CC12CCC(C1)C(C)(C)C2Nc1ccc(C(F)(F)F)nc1.
What is the InChIKey of 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The InChIKey is FWVBJEUOEICVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3N2/c1-14(2)10-6-7-15(3,8-10)13(14)21-11-4-5-12(20-9-11)16(17,18)19/h4-5,9-10,13,21H,6-8H2,1-3H3.
What are the key properties of 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine has a molecular weight of 298.35 g/mol, XLogP of 4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine is sourced from PubChem (CID 82794764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).