About N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine
N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine (PubChem CID 82794972) has the molecular formula C10H13F3N2O
and a molecular weight of 234.22 g/mol. Its IUPAC name is N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine |
| PubChem CID | 82794972 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine |
| SMILES | CNc1cccc(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O/c1-14-8-4-2-5-9(15-8)16-7-3-6-10(11,12)13/h2,4-5H,3,6-7H2,1H3,(H,14,15) |
| InChIKey | GULYCJHFXOHXEY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine?
The IUPAC name of N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine (CID 82794972) is N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine.
What is the SMILES notation for N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine?
The canonical SMILES for N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine is CNc1cccc(OCCCC(F)(F)F)n1.
What is the InChIKey of N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine?
The InChIKey is GULYCJHFXOHXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O/c1-14-8-4-2-5-9(15-8)16-7-3-6-10(11,12)13/h2,4-5H,3,6-7H2,1H3,(H,14,15).
What are the key properties of N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine?
N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine has a molecular weight of 234.22 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(4,4,4-trifluorobutoxy)pyridin-2-amine is sourced from PubChem (CID 82794972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).